[(Trifluoromethanesulfonyl)ethynyl]benzene
2-(trifluoromethylsulfonyl)ethynylbenzene
Also Known As: 2-triflylethynylbenzene|phenylethynyl trifluoromethyl sulfone|Trifluoromethylphenylethynyl sulfone|[(Trifluoromethanesulfonyl)ethynyl]benzene|(Phenylethynyl)(trifluoromethyl) sulfone|(Trifluoromethyl)(phenylethynyl) sulfone|2-(trifluoromethylsulfonyl)ethynylbenzene|(((trifluoromethyl)sulfonyl)ethynyl)benzene|2-(trifluoromethylsulfonyl)-ethynyl-benzene|1-(Trifluoromethylsulfonyl)-2-phenylacetylene|(2-TRIFLUOROMETHANESULFONYLETHYNYL)BENZENE|2-Phenyl-1-[(trifluoromethyl)sulfonyl]acetylene|[2-[(Trifluoromethyl)sulfonyl]ethynyl]benzene; (((Trifluoromethyl)sulfonyl)ethynyl)benzene; (2-Trifluoromethanesulfonylethynyl)benzene
| Molecular Formula | C9H5F3O2S |
|---|---|
| Molecular Weight | 233.99623 g/mol |
| LogP | 3.0 |
| Topological Polar Surface Area | 42.5 Ų |
| Hydrogen Bond Donors | 0 |
| Hydrogen Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Exact Mass | 233.99623 |
| Monoisotopic Mass | 233.99623 |
| Heavy Atoms | 15 |
| Complexity | 371.0 |
Chemical Identifiers
| CAS Number | 52843-77-3 |
|---|---|
| SMILES | C1=CC=C(C=C1)C#CS(=O)(=O)C(F)(F)F |
| InChIKey | LLBCLXNPGVYXFK-UHFFFAOYSA-N |
Patent-Derived Application Labels
Derived from 3 IPC patent classification(s) across the SureChEMBL global patent database.
Product Overview
[(Trifluoromethanesulfonyl)ethynyl]benzene (CAS 52843-77-3), with molecular formula C9H5F3O2S and molecular weight 233.99623 g/mol. IUPAC: 2-(trifluoromethylsulfonyl)ethynylbenzene.
[(Trifluoromethanesulfonyl)ethynyl]benzene is a custom synthesis product. We offer services from milligram to kilogram scale.
Request a Quote »