(E)-N-(2-Methyl-5-nitrophenyl)-1-(5-nitrothiophen-2-yl)methanimine
N-(2-methyl-5-nitrophenyl)-1-(5-nitrothiophen-2-yl)methanimine
Also Known As: KS-0000494H|SR-01000204207-1|N-(2-methyl-5-nitrophenyl)-1-(5-nitrothiophen-2-yl)methanimine|(E)-N-(2-Methyl-5-nitrophenyl)-1-(5-nitrothiophen-2-yl)methanimine|(2-methyl-5-nitrophenyl)[(5-nitro-2-thienyl)methylene]amine|N-(2-METHYL-5-NITRO-PHENYL)-1-(5-NITROTHIOPHEN-2-YL)METHANIMINE|2-methyl-5-nitro-N-[(E)-(5-nitrothiophen-2-yl)methylidene]aniline|N-(2-methyl-5-nitrophenyl)-N-[(E)-(5-nitro-2-thienyl)methylidene]amine
| Molecular Formula | C12H9N3O4S |
|---|---|
| Molecular Weight | 291.03137 g/mol |
| LogP | 3.62352 |
| Topological Polar Surface Area | 98.64 Ų |
| Hydrogen Bond Donors | 0 |
| Hydrogen Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Exact Mass | 291.03137 |
| Monoisotopic Mass | 291.03137 |
| Heavy Atoms | 20 |
| Complexity | 708.478 |
Chemical Identifiers
| CAS Number | 5314-72-7 |
|---|---|
| SMILES | CC1=C(C=C(C=C1)[N+](=O)[O-])N=CC2=CC=C(S2)[N+](=O)[O-] |
Product Overview
(E)-N-(2-Methyl-5-nitrophenyl)-1-(5-nitrothiophen-2-yl)methanimine (CAS 5314-72-7), with molecular formula C12H9N3O4S and molecular weight 291.03137 g/mol. IUPAC: N-(2-methyl-5-nitrophenyl)-1-(5-nitrothiophen-2-yl)methanimine.
(E)-N-(2-Methyl-5-nitrophenyl)-1-(5-nitrothiophen-2-yl)methanimine is a custom synthesis product. We offer services from milligram to kilogram scale.
Request a Quote »