Phosphonothioic acid, methyl-, O-ethyl S-(2-(propylsulfinyl)ethyl) ester
ethoxy-methyl-[2-[(S)-propylsulfinyl]ethoxy]-sulfanylidene-λ5-phosphane
Also Known As: Phosphonothioic acid, methyl-, O-ethyl S-(2-(propylsulfinyl)ethyl) ester|O-Ethyl O-[2-(propane-1-sulfinyl)ethyl] methylphosphonothioate|O-Ethyl O-{2-[(S)-propane-1-sulfinyl]ethyl} methylphosphonothioate|Ethoxy-methyl-[2-[(S)-propylsulfinyl]ethoxy]-sulfanylidene-phosphorane|Phosphonothioic acid,methyl-,o-ethyl s-[2-(propylsulfinyl)ethyl]ester(9ci)|ethoxy-methyl-[2-[(S)-propylsulfinyl]ethoxy]-sulfanylidene-$l^{5}-phosphane|Phosphonothioic acid,methyl-, O-ethyl S-[2-(propylsulfinyl)ethyl] ester (9CI)
| Molecular Formula | C8H19O3PS2 |
|---|---|
| Molecular Weight | 258.05133 g/mol |
| LogP | 2.1375 |
| Topological Polar Surface Area | 35.53 Ų |
| Hydrogen Bond Donors | 0 |
| Hydrogen Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Exact Mass | 258.05133 |
| Monoisotopic Mass | 258.05133 |
| Heavy Atoms | 14 |
| Complexity | 220.63193 |
Chemical Identifiers
| CAS Number | 53151-69-2 |
|---|---|
| SMILES | CCC[S@](=O)CCOP(=S)(C)OCC |
Product Overview
Phosphonothioic acid, methyl-, O-ethyl S-(2-(propylsulfinyl)ethyl) ester (CAS 53151-69-2), with molecular formula C8H19O3PS2 and molecular weight 258.05133 g/mol. IUPAC: ethoxy-methyl-[2-[(S)-propylsulfinyl]ethoxy]-sulfanylidene-λ5-phosphane.