5-(4-Bromophenyl)-2-furoic acid
5-(4-bromophenyl)furan-2-carboxylic acid
Also Known As: 5-(4-Bromophenyl)-2-furoic acid|5-(4-bromophenyl)furan-2-carboxylic acid|CBMicro_017471|ACMC-20am94|DivK1c_005007|5-(p-bromophenyl)pyromucic acid|5- -2-FUROICACID98|2-Furancarboxylic acid, 5-(4-bromophenyl)-|CDS1_003967|5005AE|5-(4-Bromophenyl)-2-furoic acid 98%|5-(4-Bromophenyl)-2-furoic acid, 98%|BIM-0017499.P001|5-(4-Bromo-phenyl)-furan-2-carboxylic acid|BB 0245434|5-(4-BROMOPHENYL)-2-FUROIC ACID 98|I04-9699|SR-01000483286-1|SR-01000483286-2
| Molecular Formula | C11H7BrO3 |
|---|---|
| Molecular Weight | 265.95786 g/mol |
| LogP | 3.2 |
| Topological Polar Surface Area | 50.4 Ų |
| Hydrogen Bond Donors | 1 |
| Hydrogen Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Exact Mass | 265.95786 |
| Monoisotopic Mass | 265.95786 |
| Heavy Atoms | 15 |
| Complexity | 236.0 |
Chemical Identifiers
| CAS Number | 5324-67-4 |
|---|---|
| SMILES | C1=CC(=CC=C1C2=CC=C(O2)C(=O)O)Br |
| InChIKey | MYPDSPQSFHXXTF-UHFFFAOYSA-N |
Product Overview
5-(4-Bromophenyl)-2-furoic acid (CAS 5324-67-4), with molecular formula C11H7BrO3 and molecular weight 265.95786 g/mol. IUPAC: 5-(4-bromophenyl)furan-2-carboxylic acid.
5-(4-Bromophenyl)-2-furoic acid is a custom synthesis product. We offer services from milligram to kilogram scale.
Request a Quote »