N-(3-aminophenyl)thiophene-2-carboxamide
N-(3-aminophenyl)thiophene-2-carboxamide
Also Known As: N-(3-aminophenyl)thiophene-2-carboxamide|N-(3-aminophenyl)-2-thiophenecarboxamide|piperidine-3-carbohydrazide|3'-aminothiophene-2-carboxanilide|2-Thiophenecarboxamide, N-(3-aminophenyl)-|Thiophene-2-carboxylic acid (3-amino-phenyl)-amide|2501AE|2-Chloro-4-methylsulfonylbenzoic acid|SDCCGMLS-0042516.P002|N-(3-aminophenyl)-2-thienylcarboxamide|BAS 06839700|BB 0245296|W-9363|thiophene-2-carboxylic acid (3-aminophenyl)amide|thiophene-2-carboxylic acid(3-amino-phenyl)-amide
| Molecular Formula | C11H10N2OS |
|---|---|
| Molecular Weight | 218.05139 g/mol |
| LogP | 2.1 |
| Topological Polar Surface Area | 83.4 Ų |
| Hydrogen Bond Donors | 2 |
| Hydrogen Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Exact Mass | 218.05139 |
| Monoisotopic Mass | 218.05139 |
| Heavy Atoms | 15 |
| Complexity | 235.0 |
Chemical Identifiers
| CAS Number | 53250-83-2 |
|---|---|
| SMILES | C1=CC(=CC(=C1)NC(=O)C2=CC=CS2)N |
| InChIKey | XXGXTGNFZPKBNN-UHFFFAOYSA-N |
Product Overview
N-(3-aminophenyl)thiophene-2-carboxamide (CAS 53250-83-2), with molecular formula C11H10N2OS and molecular weight 218.05139 g/mol. IUPAC: N-(3-aminophenyl)thiophene-2-carboxamide.
N-(3-aminophenyl)thiophene-2-carboxamide is a custom synthesis product. We offer services from milligram to kilogram scale.
Request a Quote »