Methanethiol, N-cyclooctylamidino-, hydrogen sulfate (ester)
[(1-amino-2-sulfosulfanylethylidene)amino]cyclooctane
Also Known As: S-((N-Cyclooctylamidino)methyl) hydrogen thiosulfate|Methanethiol, N-cyclooctylamidino-, hydrogen sulfate (ester)|[(1-amino-2-sulfosulfanylethylidene)amino]cyclooctane|s-[(2z)-2-amino-2-(cyclooctylimino)ethyl] hydrogen sulfurothioate|{[(N-cyclooctylcarbamimidoyl)methyl]sulfanyl}sulfonic acid|Thiosulfuric acid (H2S2O3), S-[2-(cyclooctylamino)-2-iminoethyl] ester|Thiosulfuric acid hydrogen S-[2-(cyclooctylamino)-2-iminoethyl] ester
| Molecular Formula | C10H20N2O3S2 |
|---|---|
| Molecular Weight | 280.09152 g/mol |
| LogP | 1.5 |
| Topological Polar Surface Area | 126.0 Ų |
| Hydrogen Bond Donors | 2 |
| Hydrogen Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Exact Mass | 280.09152 |
| Monoisotopic Mass | 280.09152 |
| Heavy Atoms | 17 |
| Complexity | 341.0 |
Chemical Identifiers
| CAS Number | 5326-74-9 |
|---|---|
| SMILES | C1CCCC(CCC1)N=C(CSS(=O)(=O)O)N |
| InChIKey | RRXBGHRARYBGOA-UHFFFAOYSA-N |
Product Overview
Methanethiol, N-cyclooctylamidino-, hydrogen sulfate (ester) (CAS 5326-74-9), with molecular formula C10H20N2O3S2 and molecular weight 280.09152 g/mol. IUPAC: [(1-amino-2-sulfosulfanylethylidene)amino]cyclooctane.
Methanethiol, N-cyclooctylamidino-, hydrogen sulfate (ester) is a custom synthesis product. We offer services from milligram to kilogram scale.
Request a Quote »