Triethylamine, 2-(2-(6,6-dimethyl-2-norpinanyl)ethoxy)-, citrate
2-[2-(6,6-dimethyl-2-bicyclo[3.1.1]heptanyl)ethoxy]-N,N-diethylethanamine;2-hydroxypropane-1,2,3-tricarboxylic acid
Also Known As: 2-(2-(6,6-Dimethyl-2-norpinanyl)ethoxy)triethylamine citrate|Triethylamine, 2-(2-(6,6-dimethyl-2-norpinanyl)ethoxy)-, citrate|2-[2-(6,6-dimethyl-4-bicyclo[3.1.1]heptanyl)ethoxy]-N,N-diethylethanamine; 2-hydroxypropane-1,2,3-tricarboxylic acid|2-Hydroxypropane-1,2,3-tricarboxylic acid--2-[2-(6,6-dimethylbicyclo[3.1.1]heptan-2-yl)ethoxy]-N,N-diethylethan-1-amine (1/1)
| Molecular Formula | C23H41NO8 |
|---|---|
| Molecular Weight | 459.2832 g/mol |
| LogP | 2.5587 |
| Topological Polar Surface Area | 144.6 Ų |
| Hydrogen Bond Donors | 4 |
| Hydrogen Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Exact Mass | 459.2832 |
| Monoisotopic Mass | 459.2832 |
| Heavy Atoms | 32 |
| Complexity | 613.4859 |
Chemical Identifiers
| CAS Number | 53330-18-0 |
|---|---|
| SMILES | CCN(CC)CCOCCC1CCC2CC1C2(C)C.C(C(=O)O)C(CC(=O)O)(C(=O)O)O |
Product Overview
Triethylamine, 2-(2-(6,6-dimethyl-2-norpinanyl)ethoxy)-, citrate (CAS 53330-18-0), with molecular formula C23H41NO8 and molecular weight 459.2832 g/mol. IUPAC: 2-[2-(6,6-dimethyl-2-bicyclo[3.1.1]heptanyl)ethoxy]-N,N-diethylethanamine;2-hydroxypropane-1,2,3-tricarboxylic acid.