Benzenamine, 2,2'-sulfonylbis-
2-(2-aminophenyl)sulfonylaniline
Also Known As: 2,2'-Sulfonyldianiline|Benzenamine, 2,2'-sulfonylbis-|2-(2-aminophenyl)sulfonylaniline|Dapsone Impurity 4|Bis(2-aminophenyl) sulfone|starbld0007569|2,2'-Diaminodiphenylsulfone|2,2'-Sulfonylbisbenzenamine|2,2'-Diamino[sulfonylbisbenzene]|2,2'-diaminodiphenyl sulfone|bis(4,4'-aminophenyl) sulfone|2,2'-Diamino(sulfonylbisbenzene)|2,2 -Sulfonylbis(benzenamine)|2-[(2-aminophenyl)sulfonyl]aniline|2,2 -Diamino[sulfonylbisbenzene]|2-(2-AMINOBENZENESULFONYL)ANILINE|2-[(2-Aminophenyl)sulfonyl]phenylamine #
| Molecular Formula | C12H12N2O2S |
|---|---|
| Molecular Weight | 248.06195 g/mol |
| LogP | 2.1 |
| Topological Polar Surface Area | 94.6 Ų |
| Hydrogen Bond Donors | 2 |
| Hydrogen Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Exact Mass | 248.06195 |
| Monoisotopic Mass | 248.06195 |
| Heavy Atoms | 17 |
| Complexity | 322.0 |
Chemical Identifiers
| CAS Number | 53347-49-2 |
|---|---|
| SMILES | C1=CC=C(C(=C1)N)S(=O)(=O)C2=CC=CC=C2N |
| InChIKey | MYEWQUYMRFSJHT-UHFFFAOYSA-N |
Patent-Derived Application Labels
Derived from 16 IPC patent classification(s) across the SureChEMBL global patent database.
Product Overview
Benzenamine, 2,2'-sulfonylbis- (CAS 53347-49-2), with molecular formula C12H12N2O2S and molecular weight 248.06195 g/mol. IUPAC: 2-(2-aminophenyl)sulfonylaniline.