Phenyl(thiophen-2-yl)methanamine
phenyl(thiophen-2-yl)methanamine
Also Known As: phenyl(thiophen-2-yl)methanamine|1-phenyl-1-thien-2-ylmethanamine|1-phenyl-1-(2-thienyl)methanamine|phenyl-2-thienylmethylamine|phenyl(2-thienyl)methanamine|alpha-(2-Thienyl)benzylamine|a-Phenyl-2-thiophenemethanamine|alpha-Phenylthiophene-2-methaneamine|BAS 14134336|C-Phenyl-C-thiophen-2-yl-methylamine|1-PHENYL-1-(THIOPHEN-2-YL)METHANAMINE|1-PHENYL-1-THIOPHEN-2-YLMETHANAMINE|rac-C-phenyl-C-thiophen-2-yl-methylamine|J2.336.181G|Y-2353|C-Phenyl-C-thiophen-2-yl-methylamine 1HCl salt|1-METHYL-2-(4,4,5,5-TETRAMETHYL-1,3,2-DIOXABOROLAN-2-YL)-1H-IMIDAZOLE
| Molecular Formula | C11H11NS |
|---|---|
| Molecular Weight | 189.06122 g/mol |
| LogP | 2.2 |
| Topological Polar Surface Area | 54.3 Ų |
| Hydrogen Bond Donors | 1 |
| Hydrogen Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Exact Mass | 189.06122 |
| Monoisotopic Mass | 189.06122 |
| Heavy Atoms | 13 |
| Complexity | 154.0 |
Chemical Identifiers
| CAS Number | 53387-66-9 |
|---|---|
| SMILES | C1=CC=C(C=C1)C(C2=CC=CS2)N |
| InChIKey | MUAFFFYJFXPGHN-UHFFFAOYSA-N |
Patent-Derived Application Labels
Derived from 4 IPC patent classification(s) across the SureChEMBL global patent database.
Product Overview
Phenyl(thiophen-2-yl)methanamine (CAS 53387-66-9), with molecular formula C11H11NS and molecular weight 189.06122 g/mol. IUPAC: phenyl(thiophen-2-yl)methanamine.