Neopentyl glycol dimethylsulfate
(2,2-dimethyl-3-methylsulfonyloxypropyl) methanesulfonate
Also Known As: Neopentyl glycol dimethylsulfate|2,2-Dimethylpropane-1,3-diyl dimethanesulfonate|NEOPENTYL GLYCOL DIMETHYLSULFATE 97|2,2-Dimethyl-1,3-propanediol dimethylsulfate|(2,2-dimethyl-3-methylsulfonyloxypropyl) methanesulfonate|Neopentyl glycol dimethylsulfate, 97%|3-(methanesulfonyloxy)-2,2-dimethylpropyl methanesulfonate|NEOPENTYL GLYCOL DIMETHYLSULFATE97|J1.630.800E|2,2-Dimethylpropane-1,3-diyldimethanesulfonate|2,2-dimethyl-1,3-propanediol dimethanesulfonate|(2,2-dimethyl-3-methylsulfonyloxy-propyl) methanesulfonate|Bis(methanesulfonic acid)2,2-dimethylpropane-1,3-diyl ester|611-011-0
| Molecular Formula | C7H16O6S2 |
|---|---|
| Molecular Weight | 260.03882 g/mol |
| LogP | 0.3 |
| Topological Polar Surface Area | 104.0 Ų |
| Hydrogen Bond Donors | 0 |
| Hydrogen Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Exact Mass | 260.03882 |
| Monoisotopic Mass | 260.03882 |
| Heavy Atoms | 15 |
| Complexity | 342.0 |
Chemical Identifiers
| CAS Number | 53555-41-2 |
|---|---|
| SMILES | CC(C)(COS(=O)(=O)C)COS(=O)(=O)C |
| InChIKey | MBBDNGMNEVIICT-UHFFFAOYSA-N |
Patent-Derived Application Labels
Derived from 2 IPC patent classification(s) across the SureChEMBL global patent database.
Product Overview
Neopentyl glycol dimethylsulfate (CAS 53555-41-2), with molecular formula C7H16O6S2 and molecular weight 260.03882 g/mol. IUPAC: (2,2-dimethyl-3-methylsulfonyloxypropyl) methanesulfonate.