Benzyl(chloromethyl)dimethylsilane
benzyl-(chloromethyl)-dimethylsilane
Also Known As: Benzyl(chloromethyl)dimethylsilane|starbld0001625|benzyl-(chloromethyl)-dimethylsilane|benzyl chloromethyl dimethyl silane|benzylchloromethyldimethylsilane|benzylchloromethyldimethyl silane|benzylchloromethyldimethyl-silane|chloromethyl-benzyl-dimethylsilane|Benzyl-(chloromethyl)-dimethyl-silane|BENZYL(CHLOROMETHYL)DIMETHYLSILANE 97|Benzyl(chloromethyl)di(methyl)silane|[[(Chloromethyl)dimethylsilyl]methyl]benzene|J1.775.814D|Benzene,[[(chloromethyl)dimethylsilyl]methyl]-|I01-19714|623-572-9
| Molecular Formula | C10H15ClSi |
|---|---|
| Molecular Weight | 198.06316 g/mol |
| LogP | 3.2547 |
| Hydrogen Bond Donors | 0 |
| Hydrogen Bond Acceptors | 0 |
| Rotatable Bonds | 3 |
| Exact Mass | 198.06316 |
| Monoisotopic Mass | 198.06316 |
| Heavy Atoms | 12 |
| Complexity | 230.85371 |
Chemical Identifiers
| CAS Number | 5356-99-0 |
|---|---|
| SMILES | C[Si](C)(CC1=CC=CC=C1)CCl |
Product Overview
Benzyl(chloromethyl)dimethylsilane (CAS 5356-99-0), with molecular formula C10H15ClSi and molecular weight 198.06316 g/mol. IUPAC: benzyl-(chloromethyl)-dimethylsilane.
Benzyl(chloromethyl)dimethylsilane is a custom synthesis product. We offer services from milligram to kilogram scale.
Request a Quote »