N-(2-(Dimethylamino)-5-nitrophenyl)acetamide
N-[2-(dimethylamino)-5-nitrophenyl]acetamide
Also Known As: N-[2-(Dimethylamino)-5-nitrophenyl]acetamide|ACMC-1ANID|N-(2-(Dimethylamino)-5-nitrophenyl)acetamide|2'-(N,N-Dimethylamino)-5'-nitroacetanilide|Acetamide, N-[2-(dimethylamino)-5-nitrophenyl]-|2 -(Dimethylamino)-5 -nitroacetanilide|3-acetamido-4-(dimethylamino)-1-nitrobenzene|N-[2-(dimethylamino)-5-nitro-phenyl]acetamide|N-[2-(dimethylamino)-5-nitrophenyl]-acetamide|N-[2-(Dimethylamino)-5-nitrophenyl]acetamide #
| Molecular Formula | C10H13N3O3 |
|---|---|
| Molecular Weight | 223.09569 g/mol |
| LogP | 1.1 |
| Topological Polar Surface Area | 78.2 Ų |
| Hydrogen Bond Donors | 1 |
| Hydrogen Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Exact Mass | 223.09569 |
| Monoisotopic Mass | 223.09569 |
| Heavy Atoms | 16 |
| Complexity | 275.0 |
Chemical Identifiers
| CAS Number | 5367-36-2 |
|---|---|
| SMILES | CC(=O)NC1=C(C=CC(=C1)[N+](=O)[O-])N(C)C |
| InChIKey | TZSQCGFTOHIDIB-UHFFFAOYSA-N |
Patent-Derived Application Labels
Derived from 6 IPC patent classification(s) across the SureChEMBL global patent database.
Product Overview
N-(2-(Dimethylamino)-5-nitrophenyl)acetamide (CAS 5367-36-2), with molecular formula C10H13N3O3 and molecular weight 223.09569 g/mol. IUPAC: N-[2-(dimethylamino)-5-nitrophenyl]acetamide.