(E)-N-(2-Fluoro-5-nitrophenyl)-1-(4-methylphenyl)methanimine
N-(2-fluoro-5-nitrophenyl)-1-(4-methylphenyl)methanimine
Also Known As: KS-000049Z9|(2-fluoro-5-nitrophenyl)(4-methylbenzylidene)amine|2-fluoro-n-[(e)-(4-methylphenyl)methylene]-5-nitroaniline|N-(2-fluoro-5-nitrophenyl)-1-(4-methylphenyl)methanimine|(E)-N-(2-Fluoro-5-nitrophenyl)-1-(4-methylphenyl)methanimine|N-(2-FLUORO-5-NITRO-PHENYL)-1-(4-METHYLPHENYL)METHANIMINE|2-fluoro-N-[(E)-(4-methylphenyl)methylidene]-5-nitroaniline
| Molecular Formula | C14H11FN2O2 |
|---|---|
| Molecular Weight | 258.08044 g/mol |
| LogP | 3.5 |
| Topological Polar Surface Area | 58.2 Ų |
| Hydrogen Bond Donors | 0 |
| Hydrogen Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Exact Mass | 258.08044 |
| Monoisotopic Mass | 258.08044 |
| Heavy Atoms | 19 |
| Complexity | 335.0 |
Chemical Identifiers
| CAS Number | 5398-33-4 |
|---|---|
| SMILES | CC1=CC=C(C=C1)C=NC2=C(C=CC(=C2)[N+](=O)[O-])F |
| InChIKey | IWTNJOYJACMUDN-UHFFFAOYSA-N |
Product Overview
(E)-N-(2-Fluoro-5-nitrophenyl)-1-(4-methylphenyl)methanimine (CAS 5398-33-4), with molecular formula C14H11FN2O2 and molecular weight 258.08044 g/mol. IUPAC: N-(2-fluoro-5-nitrophenyl)-1-(4-methylphenyl)methanimine.
(E)-N-(2-Fluoro-5-nitrophenyl)-1-(4-methylphenyl)methanimine is a custom synthesis product. We offer services from milligram to kilogram scale.
Request a Quote »