Methyl 5-(3-aminophenyl)furan-2-carboxylate
methyl 5-(3-aminophenyl)furan-2-carboxylate
Also Known As: Methyl 5-(3-aminophenyl)furan-2-carboxylate|5-(3-Aminophenyl)furan-2-carboxylic acid methyl ester|zlchem 695|ZLD0147|Methyl 5-(3-aminophenyl)-2-furoate|7748AB|2-Furancarboxylic acid, 5-(3-aminophenyl)-, methyl ester|2-Furancarboxylic acid,5-(3-aminophenyl)-, methyl ester|Methyl 5-(3-aminophenyl)furan-2-carboxylate, 97%|S05-0084|5-(3-aminophenyl)-2-furancarboxylic acid methyl ester|624-109-3|B21|Methyl 5-(3-aminophenyl)furan-2-carboxylate, 54023-06-2, 5-(3-Aminophenyl)furan-2-carboxylic acid methyl ester, SBB014480, ZINC04245261, zlchem 695, AC1OGGOE, SureCN1143419, 648450_ALDRICH, CTK4J9349, ZLD0147, MolPort-002-054-895, ACT05984, STK691792, AKOS005255327, AG-A-80291, MCULE-4548714680, AK-29358, KB-195725, ST4140178
| Molecular Formula | C12H11NO3 |
|---|---|
| Molecular Weight | 217.0739 g/mol |
| LogP | 2.3154 |
| Topological Polar Surface Area | 65.46 Ų |
| Hydrogen Bond Donors | 1 |
| Hydrogen Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Exact Mass | 217.0739 |
| Monoisotopic Mass | 217.0739 |
| Heavy Atoms | 16 |
| Complexity | 516.48737 |
Chemical Identifiers
| CAS Number | 54023-06-2 |
|---|---|
| SMILES | COC(=O)C1=CC=C(O1)C2=CC(=CC=C2)N |
Product Overview
Methyl 5-(3-aminophenyl)furan-2-carboxylate (CAS 54023-06-2), with molecular formula C12H11NO3 and molecular weight 217.0739 g/mol. IUPAC: methyl 5-(3-aminophenyl)furan-2-carboxylate.