![1H-Indole-2-carboxamide, 5-chloro-3-[(4-methylphenyl)thio]- structure](/static/products/5407/540740-75-8.webp)
1H-Indole-2-carboxamide, 5-chloro-3-[(4-methylphenyl)thio]-
5-chloro-3-(4-methylphenyl)sulfanyl-1H-indole-2-carboxamide
Also Known As: 1H-Indole-2-carboxamide, 5-chloro-3-[(4-methylphenyl)thio]-|5-chloro-3-(4-methylphenyl)sulfanyl-1H-indole-2-carboxamide|5-chloro-3-(p-tolylsulfanyl)-1H-indole-2-carboxamide|1H-Indole-2-carboxamide,5-chloro-3-[(4-methylphenyl)thio]|5-CHLORO-3-[(4-METHYLPHENYL)SULFANYL]-1H-INDOLE-2-CARBOXAMIDE
| Molecular Formula | C16H13ClN2OS |
|---|---|
| Molecular Weight | 316.0437 g/mol |
| LogP | 4.3 |
| Topological Polar Surface Area | 84.2 Ų |
| Hydrogen Bond Donors | 2 |
| Hydrogen Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Exact Mass | 316.0437 |
| Monoisotopic Mass | 316.0437 |
| Heavy Atoms | 21 |
| Complexity | 386.0 |
Chemical Identifiers
| CAS Number | 540740-75-8 |
|---|---|
| SMILES | CC1=CC=C(C=C1)SC2=C(NC3=C2C=C(C=C3)Cl)C(=O)N |
| InChIKey | POIPVJOOGQRPFF-UHFFFAOYSA-N |
Product Overview
1H-Indole-2-carboxamide, 5-chloro-3-[(4-methylphenyl)thio]- (CAS 540740-75-8), with molecular formula C16H13ClN2OS and molecular weight 316.0437 g/mol. IUPAC: 5-chloro-3-(4-methylphenyl)sulfanyl-1H-indole-2-carboxamide.
1H-Indole-2-carboxamide, 5-chloro-3-[(4-methylphenyl)thio]- is a custom synthesis product. We offer services from milligram to kilogram scale.
Request a Quote »