AC1L6ELF
N-[2-(diethylamino)ethyl]-4-methyl-2-nitro-3-phenylmethoxybenzamide
Also Known As: NCI60_001105|3-(Benzyloxy)-N-(2-(diethylamino)ethyl)-2-(hydroxy(oxido)amino)-4-methylbenzamide|3-(benzyloxy)-n-[2-(diethylamino)ethyl]-4-methyl-2-nitrobenzamide|3-benzyloxy-N-(2-diethylaminoethyl)-4-methyl-2-nitro-benzamide|3-(benzyloxy)-N-(2-(diethylamino)ethyl)-4-methyl-2-nitrobenzamide|N-(2-diethylaminoethyl)-4-methyl-2-nitro-3-phenylmethoxybenzamide|Benzamide, N-[2-(diethylamino)ethyl]-4-methyl-2-nitro- 3-(phenylmethoxy)-|Benzamide, {N-[2-(diethylamino)ethyl]-4-methyl-2-nitro-} 3-(phenylmethoxy)-
| Molecular Formula | C21H27N3O4 |
|---|---|
| Molecular Weight | 385.20016 g/mol |
| LogP | 3.6 |
| Topological Polar Surface Area | 87.4 Ų |
| Hydrogen Bond Donors | 1 |
| Hydrogen Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Exact Mass | 385.20016 |
| Monoisotopic Mass | 385.20016 |
| Heavy Atoms | 28 |
| Complexity | 487.0 |
Chemical Identifiers
| CAS Number | 5429-15-2 |
|---|---|
| SMILES | CCN(CC)CCNC(=O)C1=C(C(=C(C=C1)C)OCC2=CC=CC=C2)[N+](=O)[O-] |
| InChIKey | DJKSAAIJNPBGNG-UHFFFAOYSA-N |
Product Overview
AC1L6ELF (CAS 5429-15-2), with molecular formula C21H27N3O4 and molecular weight 385.20016 g/mol. IUPAC: N-[2-(diethylamino)ethyl]-4-methyl-2-nitro-3-phenylmethoxybenzamide.
AC1L6ELF is a custom synthesis product. We offer services from milligram to kilogram scale.
Request a Quote »