3,9-Dihydro-1H-purine-2,6-dithione
3,7-dihydropurine-2,6-dithione
Also Known As: 2,6-Dithiopurine|2,6-Dimercaptopurine|Dithioxanthine|9H-Purine-2,6-dithiol|1H-Purine-2,6(3H,9H)-dithione|Purine-2,6-dithiol|2,6-Dithioxanthine|7H-Purine-2,6-dithiol|Purine analog|Xanthine, dithio-|3,7-dihydropurine-2,6-dithione|2,6-Dimercapto-7H-purine|2,6-Purinedithiol|2.6-Dimercaptopurine|Dithiopurine, 2,6-|ACMC-209lfp|1H-Purine-2,6-dithione, 3,7-dihydro-|Xanthine, 2,6-dithio-|3,7-Dihydro-1H-purine-2,6-dithione|2,6-Dimercaptopurine =97%|EINECS 226-608-8|1H-Purine-2, 3,7-dihydro-|Xanthine, dithio- (7CI,8CI)|3,9-dihydropurine-2,6-dithione|3,9-Dihydro-purine-2,6-dithione
| Molecular Formula | C5H4N4S2 |
|---|---|
| Molecular Weight | 183.98773 g/mol |
| LogP | 1.67808 |
| Topological Polar Surface Area | 60.26 Ų |
| Hydrogen Bond Donors | 3 |
| Hydrogen Bond Acceptors | 3 |
| Rotatable Bonds | 0 |
| Exact Mass | 183.98773 |
| Monoisotopic Mass | 183.98773 |
| Heavy Atoms | 11 |
| Complexity | 490.642 |
Chemical Identifiers
| CAS Number | 5437-25-2 |
|---|---|
| SMILES | C1=NC2=C(N1)C(=S)NC(=S)N2 |
Product Overview
3,9-Dihydro-1H-purine-2,6-dithione (CAS 5437-25-2), with molecular formula C5H4N4S2 and molecular weight 183.98773 g/mol. IUPAC: 3,7-dihydropurine-2,6-dithione.