Hexane-1,6-diyl bis(4-methylbenzenesulfonate)
6-(4-methylphenyl)sulfonyloxyhexyl 4-methylbenzenesulfonate
Also Known As: hexane-1,6-diyl bis(4-methylbenzenesulfonate)|6-(4-methylphenyl)sulfonyloxyhexyl 4-methylbenzenesulfonate|hexane-1,6-diyl-bis-(toluene-p-sulfonate)|Bis(p-toluenesulfonic acid)hexamethylene ester|J1.468.060H|1-methyl-4-[6-(4-methylphenyl)sulfonyloxyhexoxysulfonyl]benzene|6-[(4-methylphenyl)sulfonyloxy]hexyl 4-methylbenzenesulfonate|Hexane-1,6-diyl bis(4-methylbenzene-1-sulfonate)|Bis(4-methylbenzenesulfonic acid)1,6-hexanediyl ester|6-[(4-methylbenzenesulfonyl)oxy]hexyl 4-methylbenzene-1-sulfonate
| Molecular Formula | C20H26O6S2 |
|---|---|
| Molecular Weight | 426.1171 g/mol |
| LogP | 4.3 |
| Topological Polar Surface Area | 104.0 Ų |
| Hydrogen Bond Donors | 0 |
| Hydrogen Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Exact Mass | 426.1171 |
| Monoisotopic Mass | 426.1171 |
| Heavy Atoms | 28 |
| Complexity | 573.0 |
Chemical Identifiers
| CAS Number | 5437-54-7 |
|---|---|
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)OCCCCCCOS(=O)(=O)C2=CC=C(C=C2)C |
| InChIKey | YZYYIAXSSKVOGE-UHFFFAOYSA-N |
Patent-Derived Application Labels
Derived from 6 IPC patent classification(s) across the SureChEMBL global patent database.
Product Overview
Hexane-1,6-diyl bis(4-methylbenzenesulfonate) (CAS 5437-54-7), with molecular formula C20H26O6S2 and molecular weight 426.1171 g/mol. IUPAC: 6-(4-methylphenyl)sulfonyloxyhexyl 4-methylbenzenesulfonate.