4-Benzyloxybenzophenone
phenyl-(4-phenylmethoxyphenyl)methanone
Also Known As: 4-Benzyloxybenzophenone|4-(Benzyloxy)benzophenone|(4-(Benzyloxy)phenyl)(phenyl)methanone|ACMC-20amoo|phenyl-(4-phenylmethoxyphenyl)methanone|4-Benzyl-Oxybenzophenone|4-Benzyloxybenzophenone, 98%|[4-(benzyloxy)phenyl](phenyl)methanone|(4-benzyloxyphenyl)-phenyl-methanone|(4-Benzyloxy-phenyl)-phenyl-methanone|Boc-L-PhenylalanineN-carboxyanhydride|phenyl 4-(phenylmethoxy)phenyl ketone|J1.049.568G|I01-19064|4-Benzyloxybenzophenone, polymer-supported, 0.8-1.1 mmol/g on Wang resin
| Molecular Formula | C20H16O2 |
|---|---|
| Molecular Weight | 288.11502 g/mol |
| LogP | 5.1 |
| Topological Polar Surface Area | 26.3 Ų |
| Hydrogen Bond Donors | 0 |
| Hydrogen Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Exact Mass | 288.11502 |
| Monoisotopic Mass | 288.11502 |
| Heavy Atoms | 22 |
| Complexity | 332.0 |
Chemical Identifiers
| CAS Number | 54589-41-2 |
|---|---|
| SMILES | C1=CC=C(C=C1)COC2=CC=C(C=C2)C(=O)C3=CC=CC=C3 |
| InChIKey | NMPNTBQOLRXPGK-UHFFFAOYSA-N |
Patent-Derived Application Labels
Derived from 8 IPC patent classification(s) across the SureChEMBL global patent database.
Product Overview
4-Benzyloxybenzophenone (CAS 54589-41-2), with molecular formula C20H16O2 and molecular weight 288.11502 g/mol. IUPAC: phenyl-(4-phenylmethoxyphenyl)methanone.