2-Thiophenemethanol, alpha-((2-naphthylsulfinyl)methyl)-alpha-phenyl-
2-naphthalen-2-ylsulfinyl-1-phenyl-1-thiophen-2-ylethanol
Also Known As: 5-17-05-00341 (Beilstein Handbook Reference)|2-Thiophenemethanol, alpha-((2-naphthylsulfinyl)methyl)-alpha-phenyl-|alpha-((2-Naphthylsulfinyl)methyl)-alpha-phenyl-2-thiophenemethanol|2-(naphthalen-2-ylsulfinyl)-1-phenyl-1-(thiophen-2-yl)ethanol|2-Thiophenemethanol, alpha-((2-naphthalenylsulfinyl)methyl)-alpha-phenyl-|2-naphthalen-2-ylsulfinyl-1-phenyl-1-thiophen-2-ylethanol|2-(Naphthalene-2-sulfinyl)-1-phenyl-1-(thiophen-2-yl)ethan-1-ol
| Molecular Formula | C22H18O2S2 |
|---|---|
| Molecular Weight | 378.07483 g/mol |
| LogP | 4.3 |
| Topological Polar Surface Area | 84.8 Ų |
| Hydrogen Bond Donors | 1 |
| Hydrogen Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Exact Mass | 378.07483 |
| Monoisotopic Mass | 378.07483 |
| Heavy Atoms | 26 |
| Complexity | 491.0 |
Chemical Identifiers
| CAS Number | 5462-25-9 |
|---|---|
| SMILES | C1=CC=C(C=C1)C(CS(=O)C2=CC3=CC=CC=C3C=C2)(C4=CC=CS4)O |
| InChIKey | WMRQXVJNQZRGDW-UHFFFAOYSA-N |
Product Overview
2-Thiophenemethanol, alpha-((2-naphthylsulfinyl)methyl)-alpha-phenyl- (CAS 5462-25-9), with molecular formula C22H18O2S2 and molecular weight 378.07483 g/mol. IUPAC: 2-naphthalen-2-ylsulfinyl-1-phenyl-1-thiophen-2-ylethanol.
2-Thiophenemethanol, alpha-((2-naphthylsulfinyl)methyl)-alpha-phenyl- is a custom synthesis product. We offer services from milligram to kilogram scale.
Request a Quote »