D-Galactose diethyldithioacetal
(2R,3S,4S,5R)-6,6-bis(ethylsulfanyl)hexane-1,2,3,4,5-pentol
Also Known As: D-Galactose diethyldithioacetal|D-Galactose-diethylmercaptal|d-galactose diethyl dithioacetal|Diethyl dithioacetal D-galactose|D-GLUCOSE DIETHYL MERCAPTAL|1,1-Bis(ethylthio)-1-deoxo-D-galactose|1,1-Bis(ethylthio)-1-deoxy-D-galactitol|(2R,3S,4S,5R)-6,6-bis(ethylsulfanyl)hexane-1,2,3,4,5-pentol|6,6-bis(ethylsulfanyl)hexane-1,2,3,4,5-pentol|Diethyl dithioacetal D-galactose, Min. 98%|J1.043.775J|(2R,3S,4S,5R)-6,6-Bis(ethylsulfanyl)-1,2,3,4,5-hexanepentol|(2R,3S,4S,5R)-6,6-Bis(ethylthio)hexane-1,2,3,4,5-pentaol
| Molecular Formula | C10H22O5S2 |
|---|---|
| Molecular Weight | 286.09088 g/mol |
| LogP | -0.7454 |
| Topological Polar Surface Area | 101.15 Ų |
| Hydrogen Bond Donors | 5 |
| Hydrogen Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Exact Mass | 286.09088 |
| Monoisotopic Mass | 286.09088 |
| Heavy Atoms | 17 |
| Complexity | 189.53506 |
Chemical Identifiers
| CAS Number | 5463-33-2 |
|---|---|
| SMILES | CCSC([C@@H]([C@H]([C@H]([C@@H](CO)O)O)O)O)SCC |
Product Overview
D-Galactose diethyldithioacetal (CAS 5463-33-2), with molecular formula C10H22O5S2 and molecular weight 286.09088 g/mol. IUPAC: (2R,3S,4S,5R)-6,6-bis(ethylsulfanyl)hexane-1,2,3,4,5-pentol.