ST50226079
cyclopentyl 4-(3-iodophenyl)-2,7,7-trimethyl-5-oxo-1,4,6,8-tetrahydroquinoline-3-carboxylate
Also Known As: Oprea1_045996|Oprea1_609529|BAS 00381658|AG-690/08351062|cyclopentyl 4-(3-iodophenyl)-2,7,7-trimethyl-5-oxo-1,4,5,6,7,8-hexahydroquinoline-3-carboxylate|SR-01000403302-1|cyclopentyl 4-(3-iodophenyl)-2,7,7-trimethyl-5-oxo-1,4,5,6,7,8-hexahydro-3-quinolinecarboxylate|cyclopentyl 4-(3-iodophenyl)-2,7,7-trimethyl-5-oxo-1,4,6,8-tetrahydroquinoline-3-carboxylate|cyclopentyl 4-(3-iodophenyl)-2,7,7-trimethyl-5-oxo-1,4,6,7,8-pentahydroquinoli ne-3-carboxylate
| Molecular Formula | C24H28INO3 |
|---|---|
| Molecular Weight | 505.1114 g/mol |
| LogP | 5.381 |
| Topological Polar Surface Area | 55.4 Ų |
| Hydrogen Bond Donors | 1 |
| Hydrogen Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Exact Mass | 505.1114 |
| Monoisotopic Mass | 505.1114 |
| Heavy Atoms | 29 |
| Complexity | 921.8084 |
Chemical Identifiers
| CAS Number | 5475-60-5 |
|---|---|
| SMILES | CC1=C(C(C2=C(N1)CC(CC2=O)(C)C)C3=CC(=CC=C3)I)C(=O)OC4CCCC4 |
Product Overview
ST50226079 (CAS 5475-60-5), with molecular formula C24H28INO3 and molecular weight 505.1114 g/mol. IUPAC: cyclopentyl 4-(3-iodophenyl)-2,7,7-trimethyl-5-oxo-1,4,6,8-tetrahydroquinoline-3-carboxylate.