AC1LK3ZT
(E)-3-(4-methoxyphenyl)-N-[[3-[[[(E)-3-(4-methoxyphenyl)prop-2-enoyl]amino]methyl]phenyl]methyl]prop-2-enamide
Also Known As: AK-968/14003343|(E)-3-(4-methoxyphenyl)-N-[[3-[[[(E)-3-(4-methoxyphenyl)prop-2-enoyl]amino]methyl]phenyl]methyl]prop-2-enamide|3-(4-methoxyphenyl)-N-[3-({[3-(4-methoxyphenyl)acryloyl]amino}methyl)benzyl]acrylamide|(2E,2'E)-N,N'-(benzene-1,3-diyldimethanediyl)bis[3-(4-methoxyphenyl)prop-2-enamide]|(2E)-N-[(3-{[(2E)-3-(4-methoxyphenyl)prop-2-enoylamino]methyl}phenyl)methyl]-3 -(4-methoxyphenyl)prop-2-enamide
| Molecular Formula | C28H28N2O4 |
|---|---|
| Molecular Weight | 456.2049 g/mol |
| LogP | 4.363 |
| Topological Polar Surface Area | 76.66 Ų |
| Hydrogen Bond Donors | 2 |
| Hydrogen Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Exact Mass | 456.2049 |
| Monoisotopic Mass | 456.2049 |
| Heavy Atoms | 34 |
| Complexity | 1061.0334 |
Chemical Identifiers
| CAS Number | 548451-89-4 |
|---|---|
| SMILES | COC1=CC=C(C=C1)/C=C/C(=O)NCC2=CC(=CC=C2)CNC(=O)/C=C/C3=CC=C(C=C3)OC |
Product Overview
AC1LK3ZT (CAS 548451-89-4), with molecular formula C28H28N2O4 and molecular weight 456.2049 g/mol. IUPAC: (E)-3-(4-methoxyphenyl)-N-[[3-[[[(E)-3-(4-methoxyphenyl)prop-2-enoyl]amino]methyl]phenyl]methyl]prop-2-enamide.