Pterosin O
(2R)-6-(2-methoxyethyl)-2,5,7-trimethyl-2,3-dihydroinden-1-one
Also Known As: Pterosin O|2(R)-pterosin O|(R)-2,3-Dihydro-6-(2-methoxyethyl)-2,5,7-trimethyl-1H-inden-1-one|(2R)-6-(2-methoxyethyl)-2,5,7-trimethyl-2,3-dihydroinden-1-one|-2,3-dihydro-6-2,5,7-trimethyl-1h-inden-1-one|1H-Inden-1-one, 2,3-dihydro-6-(2-methoxyethyl)-2,5,7-trimethyl-, (R)-|-2,3-Dihydro-6- -2,5,7-trimethyl-1H-inden-1-one|(2R)-6-(2-methoxyethyl)-2,5,7-trimethyl-2,3-dihydro-1H-inden-1-one|1H-Inden-1-one, 2,3-dihydro-6-(2-methoxyethyl)-2,5,7-trimethyl-, (2R)-|(2R)-2,3-DIHYDRO-6-(2-METHOXYETHYL)-2,5,7-TRIMETHYL-1H-INDEN-1-ONE|6-(2-methoxyethyl)-2,5,7-trimethyl-2,3-dihydro-1H-inden-1-one|1H-Inden-1-one, 2,3-dihydro-6-(2-methoxyethyl)-2,5,7-trimethyl-,(R)-
| Molecular Formula | C15H20O2 |
|---|---|
| Molecular Weight | 232.14633 g/mol |
| LogP | 3.1 |
| Topological Polar Surface Area | 26.3 Ų |
| Hydrogen Bond Donors | 0 |
| Hydrogen Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Exact Mass | 232.14633 |
| Monoisotopic Mass | 232.14633 |
| Heavy Atoms | 17 |
| Complexity | 287.0 |
Chemical Identifiers
| CAS Number | 54854-89-6 |
|---|---|
| SMILES | C[C@@H]1CC2=C(C1=O)C(=C(C(=C2)C)CCOC)C |
| InChIKey | YGMHYALYIOLFQS-SNVBAGLBSA-N |
Product Overview
Pterosin O (CAS 54854-89-6), with molecular formula C15H20O2 and molecular weight 232.14633 g/mol. IUPAC: (2R)-6-(2-methoxyethyl)-2,5,7-trimethyl-2,3-dihydroinden-1-one.
Pterosin O is a custom synthesis product. We offer services from milligram to kilogram scale.
Request a Quote »