5,6,7,8-Tetrahydro-2-methoxy-5,5-dimethylanthracene-1,4-dione
3-methoxy-8,8-dimethyl-6,7-dihydro-5H-anthracene-1,4-dione
Also Known As: 5,6,7,8-Tetrahydro-2-methoxy-5,5-dimethylanthracene-1,4-dione|1,4-Anthracenedione, 5,6,7,8-tetrahydro-2-methoxy-5,5-dimethyl-|3-methoxy-8,8-dimethyl-6,7-dihydro-5H-anthracene-1,4-dione|2-methoxy-5,5-dimethyl-1,4,5,6,7,8-hexahydroanthracene-1,4-dione|2-Methoxy-5,5-dimethyl-5,6,7,8-tetrahydro-1,4-anthracenedione|2-Methoxy-5,5-dimethyl-5,6,7,8-tetrahydro-1,4-anthracenedione #
| Molecular Formula | C17H18O3 |
|---|---|
| Molecular Weight | 270.12558 g/mol |
| LogP | 3.9 |
| Topological Polar Surface Area | 43.4 Ų |
| Hydrogen Bond Donors | 0 |
| Hydrogen Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Exact Mass | 270.12558 |
| Monoisotopic Mass | 270.12558 |
| Heavy Atoms | 20 |
| Complexity | 475.0 |
Chemical Identifiers
| CAS Number | 54889-74-6 |
|---|---|
| SMILES | CC1(CCCC2=CC3=C(C=C21)C(=O)C=C(C3=O)OC)C |
| InChIKey | QZAHTDMEYDBFTQ-UHFFFAOYSA-N |
Product Overview
5,6,7,8-Tetrahydro-2-methoxy-5,5-dimethylanthracene-1,4-dione (CAS 54889-74-6), with molecular formula C17H18O3 and molecular weight 270.12558 g/mol. IUPAC: 3-methoxy-8,8-dimethyl-6,7-dihydro-5H-anthracene-1,4-dione.
5,6,7,8-Tetrahydro-2-methoxy-5,5-dimethylanthracene-1,4-dione is a custom synthesis product. We offer services from milligram to kilogram scale.
Request a Quote »