GNF-Pf-562
4-(dichloromethylidene)-2-phenyl-1,3-oxazol-5-one
Also Known As: BAS 00084214|5(4H)-Oxazolone, 4-(dichloromethylene)-2-phenyl-|4-(dichloromethylidene)-2-phenyl-1,3-oxazol-5-one|4-(Dichloromethylene)-2-phenyloxazol-5(4H)-one|J2.391.458A|Oxazol-5(4H)-one, 4-dichloromethylene-2-phenyl-|4-Dichloromethylene-2-phenyl-4H-oxazol-5-one|2-phenyl-4-dichloromethylideneoxazol-5(4H)-one|2-Phenyl-4-(dichloromethylene)-2-oxazoline-5-one|4-(Dichloromethylene)-2-phenyl-1,3-oxazol-5(4H)-one|4-(dichloromethylidene)-2-phenyl-1,3-oxazol-5(4H)-one|AE-848/32603035|4-(Dichloromethylene)-2-phenyl-1,3-oxazol-5(4H)-one #|4-(dichloromethylidene)-2-phenyl-4,5-dihydro-1,3-oxazol-5-one
| Molecular Formula | C10H5Cl2NO2 |
|---|---|
| Molecular Weight | 240.96973 g/mol |
| LogP | 3.2 |
| Topological Polar Surface Area | 38.7 Ų |
| Hydrogen Bond Donors | 0 |
| Hydrogen Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Exact Mass | 240.96973 |
| Monoisotopic Mass | 240.96973 |
| Heavy Atoms | 15 |
| Complexity | 339.0 |
Chemical Identifiers
| CAS Number | 54902-24-8 |
|---|---|
| SMILES | C1=CC=C(C=C1)C2=NC(=C(Cl)Cl)C(=O)O2 |
| InChIKey | YFQCWRFRSGFFTC-UHFFFAOYSA-N |
Product Overview
GNF-Pf-562 (CAS 54902-24-8), with molecular formula C10H5Cl2NO2 and molecular weight 240.96973 g/mol. IUPAC: 4-(dichloromethylidene)-2-phenyl-1,3-oxazol-5-one.
GNF-Pf-562 is a custom synthesis product. We offer services from milligram to kilogram scale.
Request a Quote »