4-(Chloromethyl)-2-(thiophen-2-yl)-1,3-thiazole
4-(chloromethyl)-2-thiophen-2-yl-1,3-thiazole
Also Known As: 4-(CHLOROMETHYL)-2-(2-THIENYL)-1,3-THIAZOLE|4-(chloromethyl)-2-(thiophen-2-yl)thiazole|4-(chloromethyl)-2-(thiophen-2-yl)-1,3-thiazole|thiazole, 4-(chloromethyl)-2-(2-thienyl)-|4-(chloromethyl)-2-thiophen-2-yl-1,3-thiazole|4-(chloromethyl)-2-thien-2-yl-1,3-thiazole|4-chloromethyl-2-(2-thienyl)thiazole|4- -2- -1,3-THIAZOLE|Thiazole,4-(chloromethyl)-2-(2-thienyl)-|4-chloromethyl-2-thiophen-2-yl-thiazole|2-(2-Thienyl)-4-(chloromethyl)thiazole|4-(Chloromethyl)-2-(2-thienyl)thiazole|J2.310.031B|4-(Chloromethyl)-2-(2-thienyl)-1,3-thiazole, AldrichCPR|996-918-2
| Molecular Formula | C8H6ClNS2 |
|---|---|
| Molecular Weight | 214.96301 g/mol |
| LogP | 2.8 |
| Topological Polar Surface Area | 69.4 Ų |
| Hydrogen Bond Donors | 0 |
| Hydrogen Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Exact Mass | 214.96301 |
| Monoisotopic Mass | 214.96301 |
| Heavy Atoms | 12 |
| Complexity | 156.0 |
Chemical Identifiers
| CAS Number | 54934-70-2 |
|---|---|
| SMILES | C1=CSC(=C1)C2=NC(=CS2)CCl |
| InChIKey | CGJJBHKYGNSTDK-UHFFFAOYSA-N |
Patent-Derived Application Labels
Derived from 2 IPC patent classification(s) across the SureChEMBL global patent database.
Product Overview
4-(Chloromethyl)-2-(thiophen-2-yl)-1,3-thiazole (CAS 54934-70-2), with molecular formula C8H6ClNS2 and molecular weight 214.96301 g/mol. IUPAC: 4-(chloromethyl)-2-thiophen-2-yl-1,3-thiazole.