1,1-Dichloroethene;methyl prop-2-enoate;oxiran-2-ylmethyl 2-methylprop-2-enoate
1,1-dichloroethene;methyl prop-2-enoate;oxiran-2-ylmethyl 2-methylprop-2-enoate
Also Known As: (C7-H10-O3.C4-H6-O2.C2-H2-Cl2)x-|Vinylidene chloride, methyl acrylate, glycidyl methacrylate polymer|1,1-dichloroethene; methyl prop-2-enoate; oxiran-2-ylmethyl 2-methylprop-2-enoate|2-Propenoic acid, 2-methyl-, 2-oxiranylmethyl ester, polymer with 1,1-dichloroethene and methyl 2-propenoate|2-Propenoic acid, 2-methyl-, oxiranylmethyl ester, polymer with 1,1-dichloroethene and methyl 2-propenoate
| Molecular Formula | C13H18Cl2O5 |
|---|---|
| Molecular Weight | 324.05313 g/mol |
| LogP | 2.7851 |
| Topological Polar Surface Area | 65.1 Ų |
| Hydrogen Bond Donors | 0 |
| Hydrogen Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Exact Mass | 324.05313 |
| Monoisotopic Mass | 324.05313 |
| Heavy Atoms | 20 |
| Complexity | 255.0 |
Chemical Identifiers
| CAS Number | 54975-10-9 |
|---|---|
| SMILES | CC(=C)C(=O)OCC1CO1.COC(=O)C=C.C=C(Cl)Cl |
| InChIKey | ASRVRQSDCSQIHT-UHFFFAOYSA-N |
Product Overview
1,1-Dichloroethene;methyl prop-2-enoate;oxiran-2-ylmethyl 2-methylprop-2-enoate (CAS 54975-10-9), with molecular formula C13H18Cl2O5 and molecular weight 324.05313 g/mol. IUPAC: 1,1-dichloroethene;methyl prop-2-enoate;oxiran-2-ylmethyl 2-methylprop-2-enoate.