Methyl 3-(4-chlorophenylthio)-2-methylpropionate
methyl 3-(4-chlorophenyl)sulfanyl-2-methylpropanoate
Also Known As: Methyl 3-(4-chlorophenylthio)-2-methylpropionate|METHYL 3-(P-CHLOROBENZYLTHIO)ISOBUTYRATE|Methyl 3-[(4-chlorophenyl)sulfanyl]-2-methylpropanoate|methyl 3-(4-chlorophenyl)sulfanyl-2-methylpropanoate|J2.818.286D|methyl 3-[(4-chlorophenyl)thio]-2-methylpropanoate|3-(p-Chlorphenylthio)-2-methylpropionsaeuremethylester|2-Methyl-3-(4-chlorophenylthio)propanoic acid methyl ester|2H-Pyran,2,2'-[1,12-dodecanediylbis(oxy)]bis[tetrahydro|Methyl 3-[(4-chlorophenyl)sulfanyl]-2-methylpropanoate #|666-843-7
| Molecular Formula | C11H13ClO2S |
|---|---|
| Molecular Weight | 244.03249 g/mol |
| LogP | 3.5 |
| Topological Polar Surface Area | 51.6 Ų |
| Hydrogen Bond Donors | 0 |
| Hydrogen Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Exact Mass | 244.03249 |
| Monoisotopic Mass | 244.03249 |
| Heavy Atoms | 15 |
| Complexity | 203.0 |
Chemical Identifiers
| CAS Number | 55009-84-2 |
|---|---|
| SMILES | CC(CSC1=CC=C(C=C1)Cl)C(=O)OC |
| InChIKey | LQTPIEYMBJPFQS-UHFFFAOYSA-N |
Product Overview
Methyl 3-(4-chlorophenylthio)-2-methylpropionate (CAS 55009-84-2), with molecular formula C11H13ClO2S and molecular weight 244.03249 g/mol. IUPAC: methyl 3-(4-chlorophenyl)sulfanyl-2-methylpropanoate.