2H-Tetrazole-5-carboxylic acid, 2-(3-chlorophenyl)-, ethyl ester
ethyl 2-(3-chlorophenyl)tetrazole-5-carboxylate
Also Known As: 2-2h-tetrazole-5-carboxylicacidethylester|2- -2H-tetrazole-5-carboxylicacidethylester|Ethyl 2-(3-chlorophenyl)-2H-tetraazole-5-carboxylate|ethyl 2-(3-chlorophenyl)tetrazole-5-carboxylate|2-(3-Chloro-phenyl)-2H-tetrazole-5-carboxylic acid ethyl ester|2-(3-Chlorophenyl)-2H-tetrazole-5-carboxylic acid ethyl ester|Ethyl 2-(3-chlorophenyl)-2H-tetraazole-5-carboxylate #|2H-Tetrazole-5-carboxylic acid, 2-(3-chlorophenyl)-, ethyl ester|ethyl 2-(3-chlorophenyl)-2H-1,2,3,4-tetrazole-5-carboxylate
| Molecular Formula | C10H9ClN4O2 |
|---|---|
| Molecular Weight | 252.0414 g/mol |
| LogP | 3.0 |
| Topological Polar Surface Area | 69.9 Ų |
| Hydrogen Bond Donors | 0 |
| Hydrogen Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Exact Mass | 252.0414 |
| Monoisotopic Mass | 252.0414 |
| Heavy Atoms | 17 |
| Complexity | 279.0 |
Chemical Identifiers
| CAS Number | 55044-76-3 |
|---|---|
| SMILES | CCOC(=O)C1=NN(N=N1)C2=CC(=CC=C2)Cl |
| InChIKey | BFKQKRPAXTWNQJ-UHFFFAOYSA-N |
Product Overview
2H-Tetrazole-5-carboxylic acid, 2-(3-chlorophenyl)-, ethyl ester (CAS 55044-76-3), with molecular formula C10H9ClN4O2 and molecular weight 252.0414 g/mol. IUPAC: ethyl 2-(3-chlorophenyl)tetrazole-5-carboxylate.