(+)-Eriodictyol
(2S)-2-(3,4-dihydroxyphenyl)-5,7-dihydroxy-2,3-dihydrochromen-4-one
Also Known As: ERIODICTYOL|Eriodictiol|Huazhongilexone|(+)-Eriodictyol|eridioctyol|eriodicryol|eriodyctiol|eryodictiol|(S)-Eriodictyol|Eriodictyol - 98%|4'-hydroxynaringenin|Eriodictyol - 90%|Eriodictyol with HPLC|ERIODICTYOL [MI]|3',4',5,7-Tetrahydroxyflavanone|(S)-2-(3,4-dihydroxyphenyl)-5,7-dihydroxychroman-4-one|Eriodictyol, analytical standard|EINECS 209-016-4|(S)-2-(3,4-Dihydroxyphenyl)-2,3-dihydro-5,7-dihydroxy-4-benzopyrone|5,7,3'',4''-tetrahydroxyflavon|HY-N0637|Eriodictyol, >=95.0% (HPLC)|ERIODICTYOL (REFERENCE GRADE)
| Molecular Formula | C15H12O6 |
|---|---|
| Molecular Weight | 288.0634 g/mol |
| LogP | 2.0 |
| Topological Polar Surface Area | 107.0 Ų |
| Hydrogen Bond Donors | 4 |
| Hydrogen Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Exact Mass | 288.0634 |
| Monoisotopic Mass | 288.0634 |
| Heavy Atoms | 21 |
| Complexity | 400.0 |
Chemical Identifiers
| CAS Number | 552-58-9 |
|---|---|
| SMILES | C1[C@H](OC2=CC(=CC(=C2C1=O)O)O)C3=CC(=C(C=C3)O)O |
| InChIKey | SBHXYTNGIZCORC-ZDUSSCGKSA-N |
Patent-Derived Application Labels
Derived from 15 IPC patent classification(s) across the SureChEMBL global patent database.
Product Overview
(+)-Eriodictyol (CAS 552-58-9), with molecular formula C15H12O6 and molecular weight 288.0634 g/mol. IUPAC: (2S)-2-(3,4-dihydroxyphenyl)-5,7-dihydroxy-2,3-dihydrochromen-4-one.