2,4,6(1H,3H,5H)-Pyrimidinetrione, 1,5-diethyl-3-methyl-5-phenyl-
1,5-diethyl-3-methyl-5-phenyl-1,3-diazinane-2,4,6-trione
Also Known As: N-Ethylmethobarbital|1,5-diethyl-3-methyl-5-phenyl-1,3-diazinane-2,4,6-trione|2,4,6(1H,3H,5H)-Pyrimidinetrione, 1,5-diethyl-3-methyl-5-phenyl-|1,5-Diethyl-3-methyl-5-phenyl-2,4,6 -pyrimidinetrione|1,5-Diethyl-3-methyl-5-phenyl-2,4,6(1H,3H,5H)-pyrimidinetrione|2,4,6(1H,3H,5H)-Pyrimidinetrione,1,5-diethyl-3-methyl-5-phenyl|1,5-Diethyl-3-methyl-5-phenyl-2,4,6(1H,3H,5H)-pyrimidinetrione #
| Molecular Formula | C15H18N2O3 |
|---|---|
| Molecular Weight | 274.13174 g/mol |
| LogP | 2.0 |
| Topological Polar Surface Area | 57.7 Ų |
| Hydrogen Bond Donors | 0 |
| Hydrogen Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Exact Mass | 274.13174 |
| Monoisotopic Mass | 274.13174 |
| Heavy Atoms | 20 |
| Complexity | 429.0 |
Chemical Identifiers
| CAS Number | 55255-46-4 |
|---|---|
| SMILES | CCC1(C(=O)N(C(=O)N(C1=O)CC)C)C2=CC=CC=C2 |
| InChIKey | MKNZJVPKBDCKQB-UHFFFAOYSA-N |
Product Overview
2,4,6(1H,3H,5H)-Pyrimidinetrione, 1,5-diethyl-3-methyl-5-phenyl- (CAS 55255-46-4), with molecular formula C15H18N2O3 and molecular weight 274.13174 g/mol. IUPAC: 1,5-diethyl-3-methyl-5-phenyl-1,3-diazinane-2,4,6-trione.
2,4,6(1H,3H,5H)-Pyrimidinetrione, 1,5-diethyl-3-methyl-5-phenyl- is a custom synthesis product. We offer services from milligram to kilogram scale.
Request a Quote »