4-Ethyl-2-fluoro-1,1'-biphenyl
4-ethyl-2-fluoro-1-phenylbenzene
Also Known As: 4-ethyl-2-fluoro-1,1'-biphenyl|Flurbiprofen Impurity 4|1,1'-Biphenyl, 4-ethyl-2-fluoro-|Flurbiprofen Impurity 12|4-Ethyl-2-fluorobiphenyl|Flurbiprofen Impurity G|Flurbiprofen Impurity 1|4-ethyl-2-fluoro-1-phenylbenzene|2-fluoro-4-ethylbiphenyl|4-Ethyl-2-fluoro-biphenyl|FLURBIPROFEN IMPURITY 6|4-ethyl-2-fluoro-1-phenyl-benzene|4-Ethyl-2-fluoro-1,1-biphenyl|1-Ethyl-3-fluoro-4-phenylbenzene|KS-000031BH|2-Fluoro-4-ethyl-1,1 -biphenyl|9098P|12N-256|4-Ethyl-2-Fluoro-1,1 inverted exclamation mark -Biphenyl|4-Ethyl-2-fluoro-1,1'-biphenyl;1,1'-Biphenyl, 4-ethyl-2-fluoro-|N/A
| Molecular Formula | C14H13F |
|---|---|
| Molecular Weight | 200.10013 g/mol |
| LogP | 4.0551 |
| Hydrogen Bond Donors | 0 |
| Hydrogen Bond Acceptors | 0 |
| Rotatable Bonds | 2 |
| Exact Mass | 200.10013 |
| Monoisotopic Mass | 200.10013 |
| Heavy Atoms | 15 |
| Complexity | 446.15082 |
Chemical Identifiers
| CAS Number | 55258-76-9 |
|---|---|
| SMILES | CCC1=CC(=C(C=C1)C2=CC=CC=C2)F |
Product Overview
4-Ethyl-2-fluoro-1,1'-biphenyl (CAS 55258-76-9), with molecular formula C14H13F and molecular weight 200.10013 g/mol. IUPAC: 4-ethyl-2-fluoro-1-phenylbenzene.