Nepetoidin B
[(Z)-2-(3,4-dihydroxyphenyl)ethenyl] (E)-3-(3,4-dihydroxyphenyl)prop-2-enoate
Also Known As: Nepetoidin B|NepetoidinB|HY-N8263|NP5529|TN4648|[(Z)-2-(3,4-dihydroxyphenyl)ethenyl] (E)-3-(3,4-dihydroxyphenyl)prop-2-enoate|((Z)-2-(3,4-dihydroxyphenyl)ethenyl) (E)-3-(3,4-dihydroxyphenyl)prop-2-enoate|(1Z)-2-(3,4-dihydroxyphenyl)ethenyl (2E)-3-(3,4-dihydroxyphenyl)prop-2-enoate|(E)-3-(3,4-Dihydroxy-phenyl)-acrylic acid (Z)-2-(3,4-dihydroxy-phenyl)-vinyl ester|(E)-3-(3,4-Dihydroxyphenyl)propenoic acid (Z)-2-(3,4-dihydroxyphenyl)ethenyl ester|(Z,E)-2-(3,4-Dihydroxyphenyl) ethenyl ester of 3-(3,4-dihydroxyphenyl)-2-propenoic acid|3-(3,4-dihydroxyphenyl)-2-propenoic acid (z,e)-2-(3,4-dihydroxy-phenyl) ethenyl ester
| Molecular Formula | C17H14O6 |
|---|---|
| Molecular Weight | 314.07904 g/mol |
| LogP | 2.7363 |
| Topological Polar Surface Area | 107.22 Ų |
| Hydrogen Bond Donors | 4 |
| Hydrogen Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Exact Mass | 314.07904 |
| Monoisotopic Mass | 314.07904 |
| Heavy Atoms | 23 |
| Complexity | 776.6482 |
Chemical Identifiers
| CAS Number | 55486-06-1 |
|---|---|
| SMILES | C1=CC(=C(C=C1/C=C/C(=O)O/C=C\C2=CC(=C(C=C2)O)O)O)O |
Product Overview
Nepetoidin B (CAS 55486-06-1), with molecular formula C17H14O6 and molecular weight 314.07904 g/mol. IUPAC: [(Z)-2-(3,4-dihydroxyphenyl)ethenyl] (E)-3-(3,4-dihydroxyphenyl)prop-2-enoate.
Nepetoidin B is a custom synthesis product. We offer services from milligram to kilogram scale.
Request a Quote »