4-((4-Chlorobenzyl)thio)-5-methoxy-2-phenyl-3(2H)-pyridazinone
4-[(4-chlorophenyl)methylsulfanyl]-5-methoxy-2-phenylpyridazin-3-one
Also Known As: 4-((4-Chlorobenzyl)thio)-5-methoxy-2-phenyl-3(2H)-pyridazinone|4-((4-Chlorobenzyl)thio)-5-methoxy-2-phenylpyridazin-3(2H)-one|3(2H)-PYRIDAZINONE, 4-((P-CHLOROBENZYL)THIO)-5-METHOXY-2-PHENYL-|4-[(4-chlorophenyl)methylsulfanyl]-5-methoxy-2-phenyl-pyridazin-3-one|4-[(4-chlorophenyl)methylsulfanyl]-5-methoxy-2-phenylpyridazin-3-one|4-{[(4-Chlorophenyl)methyl]sulfanyl}-5-methoxy-2-phenylpyridazin-3(2H)-one
| Molecular Formula | C18H15ClN2O2S |
|---|---|
| Molecular Weight | 358.0543 g/mol |
| LogP | 4.1 |
| Topological Polar Surface Area | 67.2 Ų |
| Hydrogen Bond Donors | 0 |
| Hydrogen Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Exact Mass | 358.0543 |
| Monoisotopic Mass | 358.0543 |
| Heavy Atoms | 24 |
| Complexity | 509.0 |
Chemical Identifiers
| CAS Number | 5557-48-2 |
|---|---|
| SMILES | COC1=C(C(=O)N(N=C1)C2=CC=CC=C2)SCC3=CC=C(C=C3)Cl |
| InChIKey | BMFALLFAWFJQMK-UHFFFAOYSA-N |
Product Overview
4-((4-Chlorobenzyl)thio)-5-methoxy-2-phenyl-3(2H)-pyridazinone (CAS 5557-48-2), with molecular formula C18H15ClN2O2S and molecular weight 358.0543 g/mol. IUPAC: 4-[(4-chlorophenyl)methylsulfanyl]-5-methoxy-2-phenylpyridazin-3-one.
4-((4-Chlorobenzyl)thio)-5-methoxy-2-phenyl-3(2H)-pyridazinone is a custom synthesis product. We offer services from milligram to kilogram scale.
Request a Quote »