3-(Trifluoromethyl)phenyl 3-(trifluoromethyl)benzenesulfonate
[3-(trifluoromethyl)phenyl] 3-(trifluoromethyl)benzenesulfonate
Also Known As: 3-p-Aethoxyphenyl-2-thiodihydrouracil|3-(trifluoromethyl)phenyl 3-(trifluoromethyl)benzenesulfonate|[3-(trifluoromethyl)phenyl] 3-(trifluoromethyl)benzenesulfonate|[3-(trifluoromethyl)phenyl] 3-(trifluoromethyl)benzenesulfon|3-(Trifluoromethyl)phenyl 3-(trifluoromethyl)benzene-1-sulfonate|Benzenesulfonic acid,3-(trifluoromethyl)-, 3-(trifluoromethyl)phenyl ester
| Molecular Formula | C14H8F6O3S |
|---|---|
| Molecular Weight | 370.00983 g/mol |
| LogP | 4.8 |
| Topological Polar Surface Area | 51.8 Ų |
| Hydrogen Bond Donors | 0 |
| Hydrogen Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Exact Mass | 370.00983 |
| Monoisotopic Mass | 370.00983 |
| Heavy Atoms | 24 |
| Complexity | 522.0 |
Chemical Identifiers
| CAS Number | 55809-88-6 |
|---|---|
| SMILES | C1=CC(=CC(=C1)OS(=O)(=O)C2=CC=CC(=C2)C(F)(F)F)C(F)(F)F |
| InChIKey | LSGSLNMJUTXALV-UHFFFAOYSA-N |
Product Overview
3-(Trifluoromethyl)phenyl 3-(trifluoromethyl)benzenesulfonate (CAS 55809-88-6), with molecular formula C14H8F6O3S and molecular weight 370.00983 g/mol. IUPAC: [3-(trifluoromethyl)phenyl] 3-(trifluoromethyl)benzenesulfonate.
3-(Trifluoromethyl)phenyl 3-(trifluoromethyl)benzenesulfonate is a custom synthesis product. We offer services from milligram to kilogram scale.
Request a Quote »