N-Ethyl-N-methyl-1H-indole-3-ethanamine
N-ethyl-2-(1H-indol-3-yl)-N-methylethanamine
Also Known As: N-Methyl-N-ethyltryptamine|methylethyltryptamine|1H-Indole-3-ethanamine|1H-Indole-3-ethanamine, N-ethyl-N-methyl-|Indole, 3-(2-(ethylmethylamino)ethyl)-|N-ethyl-2-(1H-indol-3-yl)-N-methylethanamine|N-methyl-N-Ethyltryptamine (oxalate)|US20240317683, Compound 2|ethyl[2-(1H-indol-3-yl)ethyl]methylamine|N-Ethyl-N-methyl-1H-indole-3-ethanamine|N-Ethyl-N-methyl-1H-indole-3-ethaneamine|J2.225.014K|AD-266/41884718|N-ethyl-2-(1H-indol-3-yl)-N-methylethan-1-amine|N-ethyl-N-[2-(1H-indol-3-yl)ethyl]-N-methylamine|ETHYL-(2-(1H-INDOL-3-YL)-ETHYL)-METHYLAMINE|N-Ethyl-2-(1H-indol-3-yl)-N-methylethanamine fumarate|met
| Molecular Formula | C13H18N2 |
|---|---|
| Molecular Weight | 202.147 g/mol |
| LogP | 2.6621 |
| Topological Polar Surface Area | 19.03 Ų |
| Hydrogen Bond Donors | 1 |
| Hydrogen Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Exact Mass | 202.147 |
| Monoisotopic Mass | 202.147 |
| Heavy Atoms | 15 |
| Complexity | 430.7835 |
Chemical Identifiers
| CAS Number | 5599-69-9 |
|---|---|
| SMILES | CCN(C)CCC1=CNC2=CC=CC=C21 |
Product Overview
N-Ethyl-N-methyl-1H-indole-3-ethanamine (CAS 5599-69-9), with molecular formula C13H18N2 and molecular weight 202.147 g/mol. IUPAC: N-ethyl-2-(1H-indol-3-yl)-N-methylethanamine.
N-Ethyl-N-methyl-1H-indole-3-ethanamine is a custom synthesis product. We offer services from milligram to kilogram scale.
Request a Quote »