Pyrazole-5-methanol, 4-(dimethylamino)-1-phenyl-
[4-(dimethylamino)-1-phenylpyrazol-5-yl]methanol
Also Known As: KST-1A6043|Pyrazole-5-methanol, 4-(dimethylamino)-1-phenyl-|[4-(dimethylamino)-1-phenyl-1h-pyrazol-5-yl]methanol|4-(Dimethylamino)-1-phenylpyrazole-5-methanol|[4-(dimethylamino)-2-phenylpyrazol-3-yl]methanol|4-Dimethylamino-1-phenyl-1H-pyrazole-5-methanol|5-25-12-00396 (Beilstein Handbook Reference)|Pyrazole-5-methanol,4-(dimethylamino)-1-phenyl
| Molecular Formula | C12H15N3O |
|---|---|
| Molecular Weight | 217.1215 g/mol |
| LogP | 1.2 |
| Topological Polar Surface Area | 41.3 Ų |
| Hydrogen Bond Donors | 1 |
| Hydrogen Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Exact Mass | 217.1215 |
| Monoisotopic Mass | 217.1215 |
| Heavy Atoms | 16 |
| Complexity | 216.0 |
Chemical Identifiers
| CAS Number | 5607-45-4 |
|---|---|
| SMILES | CN(C)C1=C(N(N=C1)C2=CC=CC=C2)CO |
| InChIKey | FVXOLLKYQMDTGP-UHFFFAOYSA-N |
Product Overview
Pyrazole-5-methanol, 4-(dimethylamino)-1-phenyl- (CAS 5607-45-4), with molecular formula C12H15N3O and molecular weight 217.1215 g/mol. IUPAC: [4-(dimethylamino)-1-phenylpyrazol-5-yl]methanol.
Pyrazole-5-methanol, 4-(dimethylamino)-1-phenyl- is a custom synthesis product. We offer services from milligram to kilogram scale.
Request a Quote »