stereoisomer of 2,3-Dimethyltricyclo(2.2.1.02,6)heptane-3-carboxylic acid
2,3-dimethyltricyclo[2.2.1.02,6]heptane-3-carboxylic acid
Also Known As: alpha-Teresantalic acid|Teresantalic acid|Teresautalic acid|a-Teresantalic acid|.alpha.-Teresantalic acid|Teresantalol 8-carboxylic acid|J2.367.507B|2,3-Dimethyltricyclo[2.2.1.02,6]heptane-3-carboxylic acid|2,3-dimethyltricyclo[2.2.1.0?,?]heptane-3-carboxylic acid|2,3-Dimethyltricyclo[2.2.1.0~2,6~]heptane-3-carboxylic acid|2,3-dimethyltricyclo[2.2.1.0^{2,6}]heptane-3-carboxylic acid|Tricyclo[2.2.1.02,6]heptane-3-carboxylic acid, 2,3-dimethyl-|stereoisomer of 2,3-Dimethyltricyclo(2.2.1.02,6)heptane-3-carboxylic acid|stereoisomer of 2,3-Dimethyltricyclo[2.2.1.02,6]heptane-3-carboxylic acid
| Molecular Formula | C10H14O2 |
|---|---|
| Molecular Weight | 166.09938 g/mol |
| LogP | 1.7532 |
| Topological Polar Surface Area | 37.3 Ų |
| Hydrogen Bond Donors | 1 |
| Hydrogen Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Exact Mass | 166.09938 |
| Monoisotopic Mass | 166.09938 |
| Heavy Atoms | 12 |
| Complexity | 271.56317 |
Chemical Identifiers
| CAS Number | 562-66-3 |
|---|---|
| SMILES | CC1(C2CC3C1(C3C2)C)C(=O)O |
Product Overview
stereoisomer of 2,3-Dimethyltricyclo(2.2.1.02,6)heptane-3-carboxylic acid (CAS 562-66-3), with molecular formula C10H14O2 and molecular weight 166.09938 g/mol. IUPAC: 2,3-dimethyltricyclo[2.2.1.02,6]heptane-3-carboxylic acid.