1H-Imidazole-1-ethanol, 2-methyl-5-nitro-, hydrogen sulfate (ester)
2-(2-methyl-5-nitroimidazol-1-yl)ethyl hydrogen sulfate
Also Known As: Metronidazole-sulfate|1H-Imidazole-1-ethanol, 2-methyl-5-nitro-, hydrogen sulfate (ester)|2-Methyl-5-nitro-1H-imidazole-1-ethanol hydrogen sulfate (ester)|2-(2-methyl-5-nitroimidazol-1-yl)ethyl hydrogen sulfate|[2-(2-methyl-5-nitro-1H-imidazol-1-yl)ethoxy]sulfonic acid|2-(2-methyl-5-nitro-1H-imidazol-1-yl)ethyl hydrogen sulfate|Sulfuric acid hydrogen 2-(2-methyl-5-nitro-1H-imidazol-1-yl)ethyl ester
| Molecular Formula | C6H9N3O6S |
|---|---|
| Molecular Weight | 251.02121 g/mol |
| LogP | -0.8 |
| Topological Polar Surface Area | 136.0 Ų |
| Hydrogen Bond Donors | 1 |
| Hydrogen Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Exact Mass | 251.02121 |
| Monoisotopic Mass | 251.02121 |
| Heavy Atoms | 16 |
| Complexity | 346.0 |
Chemical Identifiers
| CAS Number | 56396-28-2 |
|---|---|
| SMILES | CC1=NC=C(N1CCOS(=O)(=O)O)[N+](=O)[O-] |
| InChIKey | CGHXCDGMIYKRME-UHFFFAOYSA-N |
Product Overview
1H-Imidazole-1-ethanol, 2-methyl-5-nitro-, hydrogen sulfate (ester) (CAS 56396-28-2), with molecular formula C6H9N3O6S and molecular weight 251.02121 g/mol. IUPAC: 2-(2-methyl-5-nitroimidazol-1-yl)ethyl hydrogen sulfate.
1H-Imidazole-1-ethanol, 2-methyl-5-nitro-, hydrogen sulfate (ester) is a custom synthesis product. We offer services from milligram to kilogram scale.
Request a Quote »