(1-Phenylcyclohexyl)methanamine
(1-phenylcyclohexyl)methanamine
Also Known As: (1-phenylcyclohexyl)methanamine|C-(1-Phenyl-cyclohexyl)-methylamine|1-(1-phenylcyclohexyl)methanamine|Cyclohexanemethanamine, 1-phenyl-|1-phenylcyclohexanemethanamine|1-Phenylcyclohexanemethylamine|(1-phenylcyclohexyl)methylamine|Cyclohexanemethylamine, 1-phenyl-|(phenylcyclohexyl)methylamine|1-Phenylcyclohexylmethanamine|c-(1-phenylcyclohexyl)methylamine|1-Phenylcyclohexane-1-methanamine|[(1-Phenylcyclohexyl)methyl]amine|1-Phenyl-1-cyclohexane-methylamine|IEM-2014|US10562878, Compound 31|5606AD|3-Methoxy-4-prop-2-ynyloxy-benzaldehyde
| Molecular Formula | C13H19N |
|---|---|
| Molecular Weight | 189.15175 g/mol |
| LogP | 3.2 |
| Topological Polar Surface Area | 26.0 Ų |
| Hydrogen Bond Donors | 1 |
| Hydrogen Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Exact Mass | 189.15175 |
| Monoisotopic Mass | 189.15175 |
| Heavy Atoms | 14 |
| Complexity | 164.0 |
Chemical Identifiers
| CAS Number | 5651-83-2 |
|---|---|
| SMILES | C1CCC(CC1)(CN)C2=CC=CC=C2 |
| InChIKey | ULRBJKIRTCBMRW-UHFFFAOYSA-N |
Patent-Derived Application Labels
Derived from 4 IPC patent classification(s) across the SureChEMBL global patent database.
Product Overview
(1-Phenylcyclohexyl)methanamine (CAS 5651-83-2), with molecular formula C13H19N and molecular weight 189.15175 g/mol. IUPAC: (1-phenylcyclohexyl)methanamine.