Methyl 3-Chloro-4-methylbenzoate
methyl 3-chloro-4-methylbenzoate
Also Known As: Methyl 3-Chloro-4-methylbenzoate|3-cyclopropylpyridine|ACMC-209lsv|Methyl 3-Chloro-p-toluate|Methyl-3-chloro-4-methylbenzoate|Methyl3-chloro-4-methylbenzoate|Benzoic acid, 3-chloro-4-methyl-, methyl ester|methyl 3-chloro-4-methyl-benzoate|methyl-3-chloro-4-metylbenzoate|Methyl4-Methyl-3-Chlorobenzoate|KS-00000UTL|2-Chloro-4-(methoxycarbonyl)toluene|Methyl 4-methyl-3-chlorobenzoate|3-Chloro-4-methylbenzoic Acid Methyl Ester|Fr12506|CK2204|CM-641|3-Chloro-p-toluic Acid Methyl Ester|AC-5778|CS-W016985|FS-2596|3-Chloro-4-methylbenzoic acidmethylester
| Molecular Formula | C9H9ClO2 |
|---|---|
| Molecular Weight | 184.02911 g/mol |
| LogP | 2.43502 |
| Topological Polar Surface Area | 26.3 Ų |
| Hydrogen Bond Donors | 0 |
| Hydrogen Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Exact Mass | 184.02911 |
| Monoisotopic Mass | 184.02911 |
| Heavy Atoms | 12 |
| Complexity | 307.39688 |
Chemical Identifiers
| CAS Number | 56525-63-4 |
|---|---|
| SMILES | CC1=C(C=C(C=C1)C(=O)OC)Cl |
Product Overview
Methyl 3-Chloro-4-methylbenzoate (CAS 56525-63-4), with molecular formula C9H9ClO2 and molecular weight 184.02911 g/mol. IUPAC: methyl 3-chloro-4-methylbenzoate.