tert-Butyldiphenylphosphine oxide
[tert-butyl(phenyl)phosphoryl]benzene
Also Known As: tert-Butyldiphenylphosphine oxide|(1,1-Dimethylethyl)diphenylphosphine oxide|D-Glucose-6,6-2H2|[tert-butyl(phenyl)phosphoryl]benzene|t-C4H9(C6H5)2PO|((CH3)3C)(C6H5)2P=O|Diphenyl tert-butylphosphine oxide|Phosphine oxide, t-butyldiphenyl-|Diphenyl(tert-butyl)phosphine oxide|tert-butyl(phenyl)phosphorosobenzene|Phosphine oxide, tert-butyldiphenyl-|Phosphine oxide, (1,1-dimethylethyl)diphenyl-|[TERT-BUTYL(PHENYL)PHOSPHOROSO]BENZENE|J1.592.788G|(1,1-Dimethylethyl)diphenylphosphine Oxide; (tert-Butyl)diphenylphosphane Oxide|N/A
| Molecular Formula | C16H19OP |
|---|---|
| Molecular Weight | 258.11734 g/mol |
| LogP | 3.5 |
| Topological Polar Surface Area | 17.1 Ų |
| Hydrogen Bond Donors | 0 |
| Hydrogen Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Exact Mass | 258.11734 |
| Monoisotopic Mass | 258.11734 |
| Heavy Atoms | 18 |
| Complexity | 282.0 |
Chemical Identifiers
| CAS Number | 56598-35-7 |
|---|---|
| SMILES | CC(C)(C)P(=O)(C1=CC=CC=C1)C2=CC=CC=C2 |
| InChIKey | CHFOAXGMRFQIOK-UHFFFAOYSA-N |
Patent-Derived Application Labels
Derived from 1 IPC patent classification(s) across the SureChEMBL global patent database.
Product Overview
tert-Butyldiphenylphosphine oxide (CAS 56598-35-7), with molecular formula C16H19OP and molecular weight 258.11734 g/mol. IUPAC: [tert-butyl(phenyl)phosphoryl]benzene.