AO-080/41182580
N-[2-chloro-5-(trifluoromethyl)phenyl]-2-hydroxybenzamide
Also Known As: N-[2-Chloro-5-(trifluoromethyl)phenyl]-2-hydroxybenzamide|CCG-631|AO-080/41182580|Benzamide, N-[2-chloro-5-(trifluoromethyl)phenyl]-2-hydroxy-|N-[2-chloro-5-(trifluoromethyl)phenyl]-2-hydroxy-benzamide|N1-[2-Chloro-5-(trifluoromethyl)phenyl]-2-hydroxybenzamide|2-Hydroxybenzoyl-N-[2-chloro-5-(trifluoromethyl)phenyl]amide|N-[2-Chloro-5-(trifluoromethyl)phenyl]-2-hydroxybenzamide #
| Molecular Formula | C14H9ClF3NO2 |
|---|---|
| Molecular Weight | 315.0274 g/mol |
| LogP | 4.5 |
| Topological Polar Surface Area | 49.3 Ų |
| Hydrogen Bond Donors | 2 |
| Hydrogen Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Exact Mass | 315.0274 |
| Monoisotopic Mass | 315.0274 |
| Heavy Atoms | 21 |
| Complexity | 378.0 |
Chemical Identifiers
| CAS Number | 5683-92-1 |
|---|---|
| SMILES | C1=CC=C(C(=C1)C(=O)NC2=C(C=CC(=C2)C(F)(F)F)Cl)O |
| InChIKey | DHBGYXBRHYAUEU-UHFFFAOYSA-N |
Product Overview
AO-080/41182580 (CAS 5683-92-1), with molecular formula C14H9ClF3NO2 and molecular weight 315.0274 g/mol. IUPAC: N-[2-chloro-5-(trifluoromethyl)phenyl]-2-hydroxybenzamide.
AO-080/41182580 is a custom synthesis product. We offer services from milligram to kilogram scale.
Request a Quote »