Methyl 5-(5-methoxycarbonylthiophen-2-yl)thiophene-2-carboxylate
methyl 5-(5-methoxycarbonylthiophen-2-yl)thiophene-2-carboxylate
Also Known As: dimethyl 5,5'-bis[2-thiophenecarboxylate]|Dimethyl [2,2'-bithiophene]-5,5'-dicarboxylate|AI-942/13331662|5,5'-dimethyl [2,2'-bithiophene]-5,5'-dicarboxylate|methyl 5-(5-methoxycarbonylthiophen-2-yl)thiophene-2-carboxylate|[2,2'-Bithiophene]-5,5'-dicarboxylic acid, dimethyl ester|[2,2']-bithiophenyl-5,5'-dicarboxylic acid dimethyl ester|2,2 -Bithiophene-5,5 -dicarboxylic acid dimethyl ester|methyl 5-[5-(methoxycarbonyl)-2-thienyl]thiophene-2-carboxylate
| Molecular Formula | C12H10O4S2 |
|---|---|
| Molecular Weight | 282.00204 g/mol |
| LogP | 3.0498 |
| Topological Polar Surface Area | 52.6 Ų |
| Hydrogen Bond Donors | 0 |
| Hydrogen Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Exact Mass | 282.00204 |
| Monoisotopic Mass | 282.00204 |
| Heavy Atoms | 18 |
| Complexity | 530.17163 |
Chemical Identifiers
| CAS Number | 5705-92-0 |
|---|---|
| SMILES | COC(=O)C1=CC=C(S1)C2=CC=C(S2)C(=O)OC |
Product Overview
Methyl 5-(5-methoxycarbonylthiophen-2-yl)thiophene-2-carboxylate (CAS 5705-92-0), with molecular formula C12H10O4S2 and molecular weight 282.00204 g/mol. IUPAC: methyl 5-(5-methoxycarbonylthiophen-2-yl)thiophene-2-carboxylate.