2,3-Dihydroxy-3-phenylpropanoic acid
2,3-dihydroxy-3-phenylpropanoic acid
Also Known As: 2,3-dihydroxy-3-phenylpropanoic acid|3-Hydroxyphenyllactate|ss-Phenylglycerinsaure|starbld0020648|Glyceric acid, 3-phenyl-|Oprea1_302742|Oprea1_623987|2-amino-3-phenylpropan-1-ol|IFLab1_004151|2,3-dihydroxy-3-phenyl propanoic acid|2,3-Dihydroxy-3-phenylpropionic acid|2,3-dihydroxy-3-phenyl-propanoic acid|Benzenepropanoicacid, a,b-dihydroxy-, (aR,bR)-rel-|Propionic acid, 2,3-dihydroxy-3-phenyl-|Benzenepropanoic acid, .alpha.,.beta.-dihydroxy-|J1.911.068K|5|A-Cholestanyl-(3|A)-hydrogensulfat,Natrium-Salz|SR-01000446453-1|867-546-7
| Molecular Formula | C9H10O4 |
|---|---|
| Molecular Weight | 182.0579 g/mol |
| Topological Polar Surface Area | 77.8 Ų |
| Hydrogen Bond Donors | 3 |
| Hydrogen Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Exact Mass | 182.0579 |
| Monoisotopic Mass | 182.0579 |
| Heavy Atoms | 13 |
| Complexity | 174.0 |
Chemical Identifiers
| CAS Number | 57230-00-9 |
|---|---|
| SMILES | C1=CC=C(C=C1)C(C(C(=O)O)O)O |
| InChIKey | BNOUUNAFHCJIJD-UHFFFAOYSA-N |
Patent-Derived Application Labels
Derived from 6 IPC patent classification(s) across the SureChEMBL global patent database.
Product Overview
2,3-Dihydroxy-3-phenylpropanoic acid (CAS 57230-00-9), with molecular formula C9H10O4 and molecular weight 182.0579 g/mol. IUPAC: 2,3-dihydroxy-3-phenylpropanoic acid.