![Ethyl 2,4-dioxo-3-phenyl-1,3,5-triazabicyclo[3.1.0]hexane-6-carboxylate structure](/static/products/5725/57258-48-7.webp)
Ethyl 2,4-dioxo-3-phenyl-1,3,5-triazabicyclo[3.1.0]hexane-6-carboxylate
ethyl 2,4-dioxo-3-phenyl-1,3,5-triazabicyclo[3.1.0]hexane-6-carboxylate
Also Known As: ethyl 2,4-dioxo-3-phenyl-1,3,5-triazabicyclo[3.1.0]hexane-6-carboxylate|ethyl 2,4-dioxo-3-phenyl-1,3,5-triazabicyclo[3.1.0]hexane-6-|6-ethoxycarbonyl-3-phenyl-1,3,5-triazabicyclo[3.1.0]hexane-2,4-dione|1,2,3,4,10,14b-Hexahydro-2-methyl-dibenzo[c,f]pyrazino[1,2-a]azepin-8-ol|3-Phenyl-2,4-dioxo-1,3,5-triazabicyclo[3.1.0]hexane-6-carboxylic acid ethyl ester
| Molecular Formula | C12H11N3O4 |
|---|---|
| Molecular Weight | 261.07495 g/mol |
| LogP | 1.2 |
| Topological Polar Surface Area | 69.7 Ų |
| Hydrogen Bond Donors | 0 |
| Hydrogen Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Exact Mass | 261.07495 |
| Monoisotopic Mass | 261.07495 |
| Heavy Atoms | 19 |
| Complexity | 411.0 |
Chemical Identifiers
| CAS Number | 57258-48-7 |
|---|---|
| SMILES | CCOC(=O)C1N2N1C(=O)N(C2=O)C3=CC=CC=C3 |
| InChIKey | OLYGJAVNKFXWLR-UHFFFAOYSA-N |
Patent-Derived Application Labels
Derived from 2 IPC patent classification(s) across the SureChEMBL global patent database.
Product Overview
Ethyl 2,4-dioxo-3-phenyl-1,3,5-triazabicyclo[3.1.0]hexane-6-carboxylate (CAS 57258-48-7), with molecular formula C12H11N3O4 and molecular weight 261.07495 g/mol. IUPAC: ethyl 2,4-dioxo-3-phenyl-1,3,5-triazabicyclo[3.1.0]hexane-6-carboxylate.