2-Thioxo-3-[4-(trifluoromethyl)phenyl]-1,3-thiazolidin-4-one
2-sulfanylidene-3-[4-(trifluoromethyl)phenyl]-1,3-thiazolidin-4-one
Also Known As: 2-thioxo-3-[4-(trifluoromethyl)phenyl]-1,3-thiazolidin-4-one|2-Thioxo-3-(4-(trifluoromethyl)phenyl)thiazolidin-4-one|5931AE|2-sulfanylidene-3-[4-(trifluoromethyl)phenyl]-1,3-thiazolidin-4-one|3-(4-(trifluoromethyl)phenyl)-2-thioxothiazolidin-4-one|2-Thioxo-3-(4-trifluoromethylphenyl)thiazolidin-4-one|I14-31011|2-thioxo-3-[4-(trifluoromethyl)phenyl]thiazolidin-4-one|4-Thiazolidinone,2-thioxo-3-[4-(trifluoromethyl)phenyl]-|2-Thioxo-3-4-(trifluoromethyl)phenyl-1,3-thiazolidin-4-one
| Molecular Formula | C10H6F3NOS2 |
|---|---|
| Molecular Weight | 276.98428 g/mol |
| LogP | 3.3 |
| Topological Polar Surface Area | 77.7 Ų |
| Hydrogen Bond Donors | 0 |
| Hydrogen Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Exact Mass | 276.98428 |
| Monoisotopic Mass | 276.98428 |
| Heavy Atoms | 17 |
| Complexity | 337.0 |
Chemical Identifiers
| CAS Number | 57669-54-2 |
|---|---|
| SMILES | C1C(=O)N(C(=S)S1)C2=CC=C(C=C2)C(F)(F)F |
| InChIKey | AJEXEUDSGYIZHZ-UHFFFAOYSA-N |
Patent-Derived Application Labels
Derived from 1 IPC patent classification(s) across the SureChEMBL global patent database.
Product Overview
2-Thioxo-3-[4-(trifluoromethyl)phenyl]-1,3-thiazolidin-4-one (CAS 57669-54-2), with molecular formula C10H6F3NOS2 and molecular weight 276.98428 g/mol. IUPAC: 2-sulfanylidene-3-[4-(trifluoromethyl)phenyl]-1,3-thiazolidin-4-one.