1,2-Diphenyl-1-ethanone oxime
N-(1,2-diphenylethylidene)hydroxylamine
Also Known As: DeoxyBenzoinOxime|deoxybenzoin oxime|1,2-diphenyl-1-ethanone oxime|Deoxybenzoic oxime|benzyl phenyl ketoxime|1,2-Diphenylethanone oxime|2-phenylacetophenone oxime|Ethanone, 1,2-diphenyl-, oxime|N-(1,2-diphenylethylidene)hydroxylamine|Parecoxib sodium Impurity 20|(Z)-1,2-Diphenylethanone oxime|1,2-Diphenyl-1-ethanoneoxime|Acetophenone, 2-phenyl-, oxime|KS-000027OP|Ethanone, 1,2-diphenyl-, oxime, (E)-|Ethanone, 1,2-diphenyl-, oxime, (1Z)-|(NE)-N-(1,2-diphenylethylidene)hydroxylamine|NSC 135001; NSC 36666|(Z)-N-(1,2-DIPHENYLETHYLIDENE)HYDROXYLAMINE|1,2-Diphenyl-1-ethanone oxime pound>>Ethanone, 1,2-diphenyl-, oxime
| Molecular Formula | C14H13NO |
|---|---|
| Molecular Weight | 211.09972 g/mol |
| LogP | 3.4 |
| Topological Polar Surface Area | 32.6 Ų |
| Hydrogen Bond Donors | 1 |
| Hydrogen Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Exact Mass | 211.09972 |
| Monoisotopic Mass | 211.09972 |
| Heavy Atoms | 16 |
| Complexity | 225.0 |
Chemical Identifiers
| CAS Number | 57736-10-4 |
|---|---|
| SMILES | C1=CC=C(C=C1)CC(=NO)C2=CC=CC=C2 |
| InChIKey | PWCUVRROUAKTLL-UHFFFAOYSA-N |
Patent-Derived Application Labels
Derived from 9 IPC patent classification(s) across the SureChEMBL global patent database.
Product Overview
1,2-Diphenyl-1-ethanone oxime (CAS 57736-10-4), with molecular formula C14H13NO and molecular weight 211.09972 g/mol. IUPAC: N-(1,2-diphenylethylidene)hydroxylamine.