AC1M028R
2-[[4-amino-5-(furan-2-yl)-1,2,4-triazol-3-yl]sulfanyl]-N-[4-chloro-3-(trifluoromethyl)phenyl]acetamide
Also Known As: 2-((4-amino-5-(furan-2-yl)-4H-1,2,4-triazol-3-yl)thio)-N-(4-chloro-3-(trifluoromethyl)phenyl)acetamide|2-{[4-amino-5-(furan-2-yl)-4H-1,2,4-triazol-3-yl]sulfanyl}-N-[4-chloro-3-(trifluoromethyl)phenyl]acetamide|F2649-0180|2-[[4-amino-5-(furan-2-yl)-1,2,4-triazol-3-yl]sulfanyl]-N-[4-chloro-3-(trifluoromethyl)phenyl]acetamide|2-(4-amino-5-(2-furyl)(1,2,4-triazol-3-ylthio))-N-[4-chloro-3-(trifluoromethyl )phenyl]acetamide
| Molecular Formula | C15H11ClF3N5O2S |
|---|---|
| Molecular Weight | 417.0274 g/mol |
| LogP | 3.6549 |
| Topological Polar Surface Area | 98.97 Ų |
| Hydrogen Bond Donors | 2 |
| Hydrogen Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Exact Mass | 417.0274 |
| Monoisotopic Mass | 417.0274 |
| Heavy Atoms | 27 |
| Complexity | 959.01575 |
Chemical Identifiers
| CAS Number | 577698-69-2 |
|---|---|
| SMILES | C1=COC(=C1)C2=NN=C(N2N)SCC(=O)NC3=CC(=C(C=C3)Cl)C(F)(F)F |
Product Overview
AC1M028R (CAS 577698-69-2), with molecular formula C15H11ClF3N5O2S and molecular weight 417.0274 g/mol. IUPAC: 2-[[4-amino-5-(furan-2-yl)-1,2,4-triazol-3-yl]sulfanyl]-N-[4-chloro-3-(trifluoromethyl)phenyl]acetamide.